C12H16I2O2 — CID 139952966
1,3-bis(2-iodoethoxymethyl)benzene (PubChem CID 139952966) has the molecular formula C12H16I2O2 and a molecular weight of 446.07 g/mol. Its IUPAC name is 1,3-bis(2-iodoethoxymethyl)benzene.
| Compound Name | 1,3-bis(2-iodoethoxymethyl)benzene |
|---|---|
| PubChem CID | 139952966 |
| Molecular Formula | C12H16I2O2 |
| Molecular Weight | 446.07 g/mol |
| Exact Mass | 445.92 |
| IUPAC Name | 1,3-bis(2-iodoethoxymethyl)benzene |
| SMILES | ICCOCc1cccc(COCCI)c1 |
| InChI | InChI=1S/C12H16I2O2/c13-4-6-15-9-11-2-1-3-12(8-11)10-16-7-5-14/h1-3,8H,4-7,9-10H2 |
| InChIKey | BQGUFDXWEMNAQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|