About CID 87259164
CID 87259164 (PubChem CID 87259164) has the molecular formula C9H11BO
and a molecular weight of 146.00 g/mol.
Molecular Properties
| Compound Name | CID 87259164 |
| PubChem CID | 87259164 |
| Molecular Formula | C9H11BO |
| Molecular Weight | 146.00 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(COCC)c1 |
| InChI | InChI=1S/C9H11BO/c1-2-11-7-8-4-3-5-9(10)6-8/h3-6H,2,7H2,1H3 |
| InChIKey | WXUIGQHCZNQUNC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.00 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87259164 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87259164?
The IUPAC name of CID 87259164 (CID 87259164) is not available.
What is the SMILES notation for CID 87259164?
The canonical SMILES for CID 87259164 is [B]c1cccc(COCC)c1.
What is the InChIKey of CID 87259164?
The InChIKey is WXUIGQHCZNQUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BO/c1-2-11-7-8-4-3-5-9(10)6-8/h3-6H,2,7H2,1H3.
What are the key properties of CID 87259164?
CID 87259164 has a molecular weight of 146.00 g/mol, XLogP of 1.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87259164 is sourced from PubChem (CID 87259164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).