C17H31NO3Si — CID 67881129
2-[[3-[2-[diethoxy(methyl)silyl]ethyl]phenyl]methoxy]-N-methylethanamine (PubChem CID 67881129) has the molecular formula C17H31NO3Si and a molecular weight of 325.53 g/mol. Its IUPAC name is 2-[[3-[2-[diethoxy(methyl)silyl]ethyl]phenyl]methoxy]-N-methylethanamine.
| Compound Name | 2-[[3-[2-[diethoxy(methyl)silyl]ethyl]phenyl]methoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 67881129 |
| Molecular Formula | C17H31NO3Si |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 2-[[3-[2-[diethoxy(methyl)silyl]ethyl]phenyl]methoxy]-N-methylethanamine |
| SMILES | CCO[Si](C)(CCc1cccc(COCCNC)c1)OCC |
| InChI | InChI=1S/C17H31NO3Si/c1-5-20-22(4,21-6-2)13-10-16-8-7-9-17(14-16)15-19-12-11-18-3/h7-9,14,18H,5-6,10-13,15H2,1-4H3 |
| InChIKey | RKQBJWPVGMSHGH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|