C24H46N2O3Si — CID 19748358
N-[[3-(aminomethyl)phenyl]methyl]-10-triethoxysilyldecan-1-amine (PubChem CID 19748358) has the molecular formula C24H46N2O3Si and a molecular weight of 438.73 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-10-triethoxysilyldecan-1-amine.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-10-triethoxysilyldecan-1-amine |
|---|---|
| PubChem CID | 19748358 |
| Molecular Formula | C24H46N2O3Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-10-triethoxysilyldecan-1-amine |
| SMILES | CCO[Si](CCCCCCCCCCNCc1cccc(CN)c1)(OCC)OCC |
| InChI | InChI=1S/C24H46N2O3Si/c1-4-27-30(28-5-2,29-6-3)19-14-12-10-8-7-9-11-13-18-26-22-24-17-15-16-23(20-24)21-25/h15-17,20,26H,4-14,18-19,21-22,25H2,1-3H3 |
| InChIKey | VTEWQBKXQMHTTJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|