C17H31N2O3Si+ — CID 101069366
2-[(4-ethenylphenyl)methylamino]ethyl-(3-trimethoxysilylpropyl)azanium (PubChem CID 101069366) has the molecular formula C17H31N2O3Si+ and a molecular weight of 339.53 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methylamino]ethyl-(3-trimethoxysilylpropyl)azanium.
| Compound Name | 2-[(4-ethenylphenyl)methylamino]ethyl-(3-trimethoxysilylpropyl)azanium |
|---|---|
| PubChem CID | 101069366 |
| Molecular Formula | C17H31N2O3Si+ |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 2-[(4-ethenylphenyl)methylamino]ethyl-(3-trimethoxysilylpropyl)azanium |
| SMILES | C=Cc1ccc(CNCC[NH2+]CCC[Si](OC)(OC)OC)cc1 |
| InChI | InChI=1S/C17H30N2O3Si/c1-5-16-7-9-17(10-8-16)15-19-13-12-18-11-6-14-23(20-2,21-3)22-4/h5,7-10,18-19H,1,6,11-15H2,2-4H3/p+1 |
| InChIKey | ZVVYXQFZOLGBKC-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|