C20H26Cl2N2 — CID 173235754
N,N'-bis[(4-ethenylphenyl)methyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 173235754) has the molecular formula C20H26Cl2N2 and a molecular weight of 365.35 g/mol. Its IUPAC name is N,N'-bis[(4-ethenylphenyl)methyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N,N'-bis[(4-ethenylphenyl)methyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 173235754 |
| Molecular Formula | C20H26Cl2N2 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N,N'-bis[(4-ethenylphenyl)methyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | C=Cc1ccc(CNCCNCc2ccc(C=C)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H24N2.2ClH/c1-3-17-5-9-19(10-6-17)15-21-13-14-22-16-20-11-7-18(4-2)8-12-20;;/h3-12,21-22H,1-2,13-16H2;2*1H |
| InChIKey | POSHRBMOTNCWKL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|