C18H33NO3SSi — CID 175770295
N-[3-(3-triethoxysilylpropylsulfanyl)propyl]aniline (PubChem CID 175770295) has the molecular formula C18H33NO3SSi and a molecular weight of 371.62 g/mol. Its IUPAC name is N-[3-(3-triethoxysilylpropylsulfanyl)propyl]aniline.
| Compound Name | N-[3-(3-triethoxysilylpropylsulfanyl)propyl]aniline |
|---|---|
| PubChem CID | 175770295 |
| Molecular Formula | C18H33NO3SSi |
| Molecular Weight | 371.62 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[3-(3-triethoxysilylpropylsulfanyl)propyl]aniline |
| SMILES | CCO[Si](CCCSCCCNc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C18H33NO3SSi/c1-4-20-24(21-5-2,22-6-3)17-11-16-23-15-10-14-19-18-12-8-7-9-13-18/h7-9,12-13,19H,4-6,10-11,14-17H2,1-3H3 |
| InChIKey | AKCDYMGGKBBGMV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|