C17H30N2O3Si — CID 88666500
1-N'-(1-phenylprop-2-enyl)-1-N-(3-trimethoxysilylpropyl)ethane-1,1-diamine (PubChem CID 88666500) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is 1-N'-(1-phenylprop-2-enyl)-1-N-(3-trimethoxysilylpropyl)ethane-1,1-diamine.
| Compound Name | 1-N'-(1-phenylprop-2-enyl)-1-N-(3-trimethoxysilylpropyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 88666500 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-N'-(1-phenylprop-2-enyl)-1-N-(3-trimethoxysilylpropyl)ethane-1,1-diamine |
| SMILES | C=CC(NC(C)NCCC[Si](OC)(OC)OC)c1ccccc1 |
| InChI | InChI=1S/C17H30N2O3Si/c1-6-17(16-11-8-7-9-12-16)19-15(2)18-13-10-14-23(20-3,21-4)22-5/h6-9,11-12,15,17-19H,1,10,13-14H2,2-5H3 |
| InChIKey | XOYCNQRVBJKANY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|