C14H26N2O3Si — CID 99738332
N'-[(2R)-3-phenyl-2-trimethoxysilylpropyl]ethane-1,2-diamine (PubChem CID 99738332) has the molecular formula C14H26N2O3Si and a molecular weight of 298.46 g/mol. Its IUPAC name is N'-[(2R)-3-phenyl-2-trimethoxysilylpropyl]ethane-1,2-diamine.
| Compound Name | N'-[(2R)-3-phenyl-2-trimethoxysilylpropyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 99738332 |
| Molecular Formula | C14H26N2O3Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N'-[(2R)-3-phenyl-2-trimethoxysilylpropyl]ethane-1,2-diamine |
| SMILES | CO[Si](OC)(OC)[C@@H](CNCCN)Cc1ccccc1 |
| InChI | InChI=1S/C14H26N2O3Si/c1-17-20(18-2,19-3)14(12-16-10-9-15)11-13-7-5-4-6-8-13/h4-8,14,16H,9-12,15H2,1-3H3/t14-/m1/s1 |
| InChIKey | WVXRXDRLELTNIS-CQSZACIVSA-N |
| XLogP | 1.03 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|