C14H26N2O3Si — CID 66659087
1-N'-ethyl-3-phenyl-2-trimethoxysilylpropane-1,1-diamine (PubChem CID 66659087) has the molecular formula C14H26N2O3Si and a molecular weight of 298.46 g/mol. Its IUPAC name is 1-N'-ethyl-3-phenyl-2-trimethoxysilylpropane-1,1-diamine.
| Compound Name | 1-N'-ethyl-3-phenyl-2-trimethoxysilylpropane-1,1-diamine |
|---|---|
| PubChem CID | 66659087 |
| Molecular Formula | C14H26N2O3Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-N'-ethyl-3-phenyl-2-trimethoxysilylpropane-1,1-diamine |
| SMILES | CCNC(N)C(Cc1ccccc1)[Si](OC)(OC)OC |
| InChI | InChI=1S/C14H26N2O3Si/c1-5-16-14(15)13(20(17-2,18-3)19-4)11-12-9-7-6-8-10-12/h6-10,13-14,16H,5,11,15H2,1-4H3 |
| InChIKey | LSCSFPYPJGZFSW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|