C23H36N2 — CID 145359006
ethane;N'-[4-phenyl-2-(2-phenylethyl)butyl]propane-1,3-diamine (PubChem CID 145359006) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is ethane;N'-[4-phenyl-2-(2-phenylethyl)butyl]propane-1,3-diamine.
| Compound Name | ethane;N'-[4-phenyl-2-(2-phenylethyl)butyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 145359006 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | ethane;N'-[4-phenyl-2-(2-phenylethyl)butyl]propane-1,3-diamine |
| SMILES | CC.NCCCNCC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C21H30N2.C2H6/c22-16-7-17-23-18-21(14-12-19-8-3-1-4-9-19)15-13-20-10-5-2-6-11-20;1-2/h1-6,8-11,21,23H,7,12-18,22H2;1-2H3 |
| InChIKey | XNAKKCXTWUSDPR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|