C11H19N3 — CID 102078830
N'-(2-amino-2-phenylethyl)propane-1,3-diamine (PubChem CID 102078830) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N'-(2-amino-2-phenylethyl)propane-1,3-diamine.
| Compound Name | N'-(2-amino-2-phenylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 102078830 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N'-(2-amino-2-phenylethyl)propane-1,3-diamine |
| SMILES | NCCCNCC(N)c1ccccc1 |
| InChI | InChI=1S/C11H19N3/c12-7-4-8-14-9-11(13)10-5-2-1-3-6-10/h1-3,5-6,11,14H,4,7-9,12-13H2 |
| InChIKey | DQVFFOIIGNTKLI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|