C11H14N2 — CID 121446388
(1R)-1-phenyl-N'-prop-2-ynylethane-1,2-diamine (PubChem CID 121446388) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (1R)-1-phenyl-N'-prop-2-ynylethane-1,2-diamine.
| Compound Name | (1R)-1-phenyl-N'-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 121446388 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1R)-1-phenyl-N'-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNC[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C11H14N2/c1-2-8-13-9-11(12)10-6-4-3-5-7-10/h1,3-7,11,13H,8-9,12H2/t11-/m0/s1 |
| InChIKey | QZOXIDILZSBCLT-NSHDSACASA-N |
| XLogP | 0.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|