C18H20N2 — CID 107292807
3,3-diphenyl-2-N-prop-2-ynylpropane-1,2-diamine (PubChem CID 107292807) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3,3-diphenyl-2-N-prop-2-ynylpropane-1,2-diamine.
| Compound Name | 3,3-diphenyl-2-N-prop-2-ynylpropane-1,2-diamine |
|---|---|
| PubChem CID | 107292807 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 3,3-diphenyl-2-N-prop-2-ynylpropane-1,2-diamine |
| SMILES | C#CCNC(CN)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2/c1-2-13-20-17(14-19)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h1,3-12,17-18,20H,13-14,19H2 |
| InChIKey | FMKCMRCOUPNLIR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|