C18H24N2 — CID 107292802
3,3-diphenyl-2-N-propylpropane-1,2-diamine (PubChem CID 107292802) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3,3-diphenyl-2-N-propylpropane-1,2-diamine.
| Compound Name | 3,3-diphenyl-2-N-propylpropane-1,2-diamine |
|---|---|
| PubChem CID | 107292802 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3,3-diphenyl-2-N-propylpropane-1,2-diamine |
| SMILES | CCCNC(CN)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24N2/c1-2-13-20-17(14-19)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-18,20H,2,13-14,19H2,1H3 |
| InChIKey | CAZCKLRIKDWXRK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |