C19H21N — CID 62233520
N-ethyl-1,1-diphenylpent-4-yn-2-amine (PubChem CID 62233520) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is N-ethyl-1,1-diphenylpent-4-yn-2-amine.
| Compound Name | N-ethyl-1,1-diphenylpent-4-yn-2-amine |
|---|---|
| PubChem CID | 62233520 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-ethyl-1,1-diphenylpent-4-yn-2-amine |
| SMILES | C#CCC(NCC)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N/c1-3-11-18(20-4-2)19(16-12-7-5-8-13-16)17-14-9-6-10-15-17/h1,5-10,12-15,18-20H,4,11H2,2H3 |
| InChIKey | WMMMTUVXSGWDKT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|