C23H42N2O6Si2 — CID 173093441
N-benzyl-3-trimethoxysilylpropan-1-amine;N-methylaniline;trimethoxysilane (PubChem CID 173093441) has the molecular formula C23H42N2O6Si2 and a molecular weight of 498.77 g/mol. Its IUPAC name is N-benzyl-3-trimethoxysilylpropan-1-amine;N-methylaniline;trimethoxysilane.
| Compound Name | N-benzyl-3-trimethoxysilylpropan-1-amine;N-methylaniline;trimethoxysilane |
|---|---|
| PubChem CID | 173093441 |
| Molecular Formula | C23H42N2O6Si2 |
| Molecular Weight | 498.77 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-benzyl-3-trimethoxysilylpropan-1-amine;N-methylaniline;trimethoxysilane |
| SMILES | CNc1ccccc1.CO[SiH](OC)OC.CO[Si](CCCNCc1ccccc1)(OC)OC |
| InChI | InChI=1S/C13H23NO3Si.C7H9N.C3H10O3Si/c1-15-18(16-2,17-3)11-7-10-14-12-13-8-5-4-6-9-13;1-8-7-5-3-2-4-6-7;1-4-7(5-2)6-3/h4-6,8-9,14H,7,10-12H2,1-3H3;2-6,8H,1H3;7H,1-3H3 |
| InChIKey | XZSTURWUAQYCMP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|