C12H22N2O3Si — CID 174059025
N-benzyl-N'-trimethoxysilylethane-1,2-diamine (PubChem CID 174059025) has the molecular formula C12H22N2O3Si and a molecular weight of 270.40 g/mol. Its IUPAC name is N-benzyl-N'-trimethoxysilylethane-1,2-diamine.
| Compound Name | N-benzyl-N'-trimethoxysilylethane-1,2-diamine |
|---|---|
| PubChem CID | 174059025 |
| Molecular Formula | C12H22N2O3Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-benzyl-N'-trimethoxysilylethane-1,2-diamine |
| SMILES | CO[Si](NCCNCc1ccccc1)(OC)OC |
| InChI | InChI=1S/C12H22N2O3Si/c1-15-18(16-2,17-3)14-10-9-13-11-12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3 |
| InChIKey | UPDUMUWRNIWWHK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|