C27H30N4 — CID 145341199
4-N-phenylbenzene-1,4-diamine;1-N-phenyl-4-N-propan-2-ylbenzene-1,4-diamine (PubChem CID 145341199) has the molecular formula C27H30N4 and a molecular weight of 410.57 g/mol. Its IUPAC name is 4-N-phenylbenzene-1,4-diamine;1-N-phenyl-4-N-propan-2-ylbenzene-1,4-diamine.
| Compound Name | 4-N-phenylbenzene-1,4-diamine;1-N-phenyl-4-N-propan-2-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 145341199 |
| Molecular Formula | C27H30N4 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 4-N-phenylbenzene-1,4-diamine;1-N-phenyl-4-N-propan-2-ylbenzene-1,4-diamine |
| SMILES | CC(C)Nc1ccc(Nc2ccccc2)cc1.Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H18N2.C12H12N2/c1-12(2)16-14-8-10-15(11-9-14)17-13-6-4-3-5-7-13;13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h3-12,16-17H,1-2H3;1-9,14H,13H2 |
| InChIKey | KHINMXCFOHQKEU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|