About 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine
1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine (PubChem CID 143284879) has the molecular formula C26H34N2
and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine |
| PubChem CID | 143284879 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine |
| SMILES | CCc1cc(C(C)C)cc(C(C)C)c1.Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C14H22.C12H12N2/c1-6-12-7-13(10(2)3)9-14(8-12)11(4)5;13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h7-11H,6H2,1-5H3;1-9,14H,13H2 |
| InChIKey | XCKOBJQWTBFPHH-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine?
The IUPAC name of 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine (CID 143284879) is 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine.
What is the SMILES notation for 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine?
The canonical SMILES for 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine is CCc1cc(C(C)C)cc(C(C)C)c1.Nc1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine?
The InChIKey is XCKOBJQWTBFPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C12H12N2/c1-6-12-7-13(10(2)3)9-14(8-12)11(4)5;13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h7-11H,6H2,1-5H3;1-9,14H,13H2.
What are the key properties of 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine?
1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine has a molecular weight of 374.57 g/mol, XLogP of 7.51, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-di(propan-2-yl)benzene;4-N-phenylbenzene-1,4-diamine is sourced from PubChem (CID 143284879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).