About N-pent-1-yn-3-ylaniline
N-pent-1-yn-3-ylaniline (PubChem CID 91154243) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is N-pent-1-yn-3-ylaniline.
Molecular Properties
| Compound Name | N-pent-1-yn-3-ylaniline |
| PubChem CID | 91154243 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-pent-1-yn-3-ylaniline |
| SMILES | C#CC(CC)Nc1ccccc1 |
| InChI | InChI=1S/C11H13N/c1-3-10(4-2)12-11-8-6-5-7-9-11/h1,5-10,12H,4H2,2H3 |
| InChIKey | UZKWZYHIUNERJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-pent-1-yn-3-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pent-1-yn-3-ylaniline?
The IUPAC name of N-pent-1-yn-3-ylaniline (CID 91154243) is N-pent-1-yn-3-ylaniline.
What is the SMILES notation for N-pent-1-yn-3-ylaniline?
The canonical SMILES for N-pent-1-yn-3-ylaniline is C#CC(CC)Nc1ccccc1.
What is the InChIKey of N-pent-1-yn-3-ylaniline?
The InChIKey is UZKWZYHIUNERJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-3-10(4-2)12-11-8-6-5-7-9-11/h1,5-10,12H,4H2,2H3.
What are the key properties of N-pent-1-yn-3-ylaniline?
N-pent-1-yn-3-ylaniline has a molecular weight of 159.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pent-1-yn-3-ylaniline is sourced from PubChem (CID 91154243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).