C9H10N2 — CID 57229627
1-N'-phenylprop-2-yne-1,1-diamine (PubChem CID 57229627) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-N'-phenylprop-2-yne-1,1-diamine.
| Compound Name | 1-N'-phenylprop-2-yne-1,1-diamine |
|---|---|
| PubChem CID | 57229627 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1-N'-phenylprop-2-yne-1,1-diamine |
| SMILES | C#CC(N)Nc1ccccc1 |
| InChI | InChI=1S/C9H10N2/c1-2-9(10)11-8-6-4-3-5-7-8/h1,3-7,9,11H,10H2 |
| InChIKey | OXCIBWKOPFKSLC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|