C21H17N — CID 11196846
N-(1,3-diphenylprop-2-ynyl)aniline (PubChem CID 11196846) has the molecular formula C21H17N and a molecular weight of 283.37 g/mol. Its IUPAC name is N-(1,3-diphenylprop-2-ynyl)aniline.
| Compound Name | N-(1,3-diphenylprop-2-ynyl)aniline |
|---|---|
| PubChem CID | 11196846 |
| Molecular Formula | C21H17N |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(1,3-diphenylprop-2-ynyl)aniline |
| SMILES | C(#CC(Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17N/c1-4-10-18(11-5-1)16-17-21(19-12-6-2-7-13-19)22-20-14-8-3-9-15-20/h1-15,21-22H |
| InChIKey | YOPGOHAFTCICOM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|