C15H13NO — CID 134926721
N-[(1R)-1,3-diphenylprop-2-ynyl]hydroxylamine (PubChem CID 134926721) has the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. Its IUPAC name is N-[(1R)-1,3-diphenylprop-2-ynyl]hydroxylamine.
| Compound Name | N-[(1R)-1,3-diphenylprop-2-ynyl]hydroxylamine |
|---|---|
| PubChem CID | 134926721 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-[(1R)-1,3-diphenylprop-2-ynyl]hydroxylamine |
| SMILES | ON[C@@H](C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13NO/c17-16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10,15-17H/t15-/m0/s1 |
| InChIKey | QFDBTYKRDZRMDH-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|