C20H21NO — CID 86086708
N-(1,3-diphenylprop-2-ynyl)-3-methylbutanamide (PubChem CID 86086708) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is N-(1,3-diphenylprop-2-ynyl)-3-methylbutanamide.
| Compound Name | N-(1,3-diphenylprop-2-ynyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 86086708 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(1,3-diphenylprop-2-ynyl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c1-16(2)15-20(22)21-19(18-11-7-4-8-12-18)14-13-17-9-5-3-6-10-17/h3-12,16,19H,15H2,1-2H3,(H,21,22) |
| InChIKey | XFRPLZIIPPOQHJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|