C19H17Cl — CID 134482693
1-chloro-2-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]benzene (PubChem CID 134482693) has the molecular formula C19H17Cl and a molecular weight of 280.80 g/mol. Its IUPAC name is 1-chloro-2-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]benzene.
| Compound Name | 1-chloro-2-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 134482693 |
| Molecular Formula | C19H17Cl |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-chloro-2-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]benzene |
| SMILES | C=C/C=C(\C=C)C(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C19H17Cl/c1-3-10-15(4-2)19(16-11-6-5-7-12-16)17-13-8-9-14-18(17)20/h3-14,19H,1-2H2/b15-10+ |
| InChIKey | REGCAESJCKUGTO-XNTDXEJSSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|