C25H23NS — CID 170720846
10-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-2,3-dihydrophenothiazine (PubChem CID 170720846) has the molecular formula C25H23NS and a molecular weight of 369.53 g/mol. Its IUPAC name is 10-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-2,3-dihydrophenothiazine.
| Compound Name | 10-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-2,3-dihydrophenothiazine |
|---|---|
| PubChem CID | 170720846 |
| Molecular Formula | C25H23NS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 10-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-2,3-dihydrophenothiazine |
| SMILES | C=C/C=C(\C=C)C(c1ccccc1)N1C2=CCCC=C2Sc2ccccc21 |
| InChI | InChI=1S/C25H23NS/c1-3-12-19(4-2)25(20-13-6-5-7-14-20)26-21-15-8-10-17-23(21)27-24-18-11-9-16-22(24)26/h3-8,10,12-18,25H,1-2,9,11H2/b19-12+ |
| InChIKey | CZIHESSESSMFML-XDHOZWIPSA-N |
| XLogP | 7.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|