C22H22 — CID 144915065
(3,6-dimethylidene-5-phenylocta-1,7-dien-4-yl)benzene (PubChem CID 144915065) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is (3,6-dimethylidene-5-phenylocta-1,7-dien-4-yl)benzene.
| Compound Name | (3,6-dimethylidene-5-phenylocta-1,7-dien-4-yl)benzene |
|---|---|
| PubChem CID | 144915065 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (3,6-dimethylidene-5-phenylocta-1,7-dien-4-yl)benzene |
| SMILES | C=CC(=C)C(c1ccccc1)C(C(=C)C=C)c1ccccc1 |
| InChI | InChI=1S/C22H22/c1-5-17(3)21(19-13-9-7-10-14-19)22(18(4)6-2)20-15-11-8-12-16-20/h5-16,21-22H,1-4H2 |
| InChIKey | AYXVZBOKWBAAIY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|