C32H37NO2 — CID 144517945
(2Z,8Z,10E)-2-[(1Z,5Z)-2-ethenyl-3-methylidenehepta-1,5-dienyl]-3,5-dimethyl-10-(4-methylanilino)-4-oxotrideca-2,5,8,10,12-pentaenal (PubChem CID 144517945) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is (2Z,8Z,10E)-2-[(1Z,5Z)-2-ethenyl-3-methylidenehepta-1,5-dienyl]-3,5-dimethyl-10-(4-methylanilino)-4-oxotrideca-2,5,8,10,12-pentaenal.
| Compound Name | (2Z,8Z,10E)-2-[(1Z,5Z)-2-ethenyl-3-methylidenehepta-1,5-dienyl]-3,5-dimethyl-10-(4-methylanilino)-4-oxotrideca-2,5,8,10,12-pentaenal |
|---|---|
| PubChem CID | 144517945 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (2Z,8Z,10E)-2-[(1Z,5Z)-2-ethenyl-3-methylidenehepta-1,5-dienyl]-3,5-dimethyl-10-(4-methylanilino)-4-oxotrideca-2,5,8,10,12-pentaenal |
| SMILES | C=C/C=C(\C=C/CC=C(C)C(=O)/C(C)=C(C=O)/C=C(/C=C)C(=C)C/C=C\C)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C32H37NO2/c1-8-11-15-25(5)28(10-3)22-29(23-34)27(7)32(35)26(6)16-12-13-17-30(14-9-2)33-31-20-18-24(4)19-21-31/h8-11,13-14,16-23,33H,2-3,5,12,15H2,1,4,6-7H3/b11-8-,17-13-,26-16?,28-22-,29-27-,30-14+ |
| InChIKey | DHGBIWVIBIKUJE-KHDFKANJSA-N |
| XLogP | 8.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|