C30H38 — CID 142975589
(7E,9E,11E)-7,10-bis(ethenyl)-11,14-dimethyl-6-methylidenepentadeca-1,3,7,9,11,14-hexaene;1,4-xylene (PubChem CID 142975589) has the molecular formula C30H38 and a molecular weight of 398.63 g/mol. Its IUPAC name is (7E,9E,11E)-7,10-bis(ethenyl)-11,14-dimethyl-6-methylidenepentadeca-1,3,7,9,11,14-hexaene;1,4-xylene.
| Compound Name | (7E,9E,11E)-7,10-bis(ethenyl)-11,14-dimethyl-6-methylidenepentadeca-1,3,7,9,11,14-hexaene;1,4-xylene |
|---|---|
| PubChem CID | 142975589 |
| Molecular Formula | C30H38 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (7E,9E,11E)-7,10-bis(ethenyl)-11,14-dimethyl-6-methylidenepentadeca-1,3,7,9,11,14-hexaene;1,4-xylene |
| SMILES | C=CC=CCC(=C)/C(C=C)=C/C=C(C=C)/C(C)=C/CC(=C)C.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C22H28.C8H10/c1-8-11-12-13-19(6)21(9-2)16-17-22(10-3)20(7)15-14-18(4)5;1-7-3-5-8(2)6-4-7/h8-12,15-17H,1-4,6,13-14H2,5,7H3;3-6H,1-2H3/b12-11?,20-15+,21-16+,22-17+; |
| InChIKey | ZROTWIUOYIPUBL-AONYBMPMSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|