C14H22O — CID 161371007
methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene (PubChem CID 161371007) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene.
| Compound Name | methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene |
|---|---|
| PubChem CID | 161371007 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene |
| SMILES | C.C.C=C/C=C/COc1ccc(C)cc1 |
| InChI | InChI=1S/C12H14O.2CH4/c1-3-4-5-10-13-12-8-6-11(2)7-9-12;;/h3-9H,1,10H2,2H3;2*1H4/b5-4+;; |
| InChIKey | VQLMWASXVMEYON-SFKRKKMESA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|