About methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene
methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene (PubChem CID 161371007) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene.
Molecular Properties
| Compound Name | methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene |
| PubChem CID | 161371007 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene |
| SMILES | C.C.C=C/C=C/COc1ccc(C)cc1 |
| InChI | InChI=1S/C12H14O.2CH4/c1-3-4-5-10-13-12-8-6-11(2)7-9-12;;/h3-9H,1,10H2,2H3;2*1H4/b5-4+;; |
| InChIKey | VQLMWASXVMEYON-SFKRKKMESA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene?
The IUPAC name of methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene (CID 161371007) is methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene.
What is the SMILES notation for methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene?
The canonical SMILES for methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene is C.C.C=C/C=C/COc1ccc(C)cc1.
What is the InChIKey of methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene?
The InChIKey is VQLMWASXVMEYON-SFKRKKMESA-N. The full InChI is InChI=1S/C12H14O.2CH4/c1-3-4-5-10-13-12-8-6-11(2)7-9-12;;/h3-9H,1,10H2,2H3;2*1H4/b5-4+;;.
What are the key properties of methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene?
methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene has a molecular weight of 206.33 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-4-[(2E)-penta-2,4-dienoxy]benzene is sourced from PubChem (CID 161371007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).