C16H24O4 — CID 174744411
1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene;propane-1,2-diol (PubChem CID 174744411) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene;propane-1,2-diol.
| Compound Name | 1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene;propane-1,2-diol |
|---|---|
| PubChem CID | 174744411 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene;propane-1,2-diol |
| SMILES | C=CCOC=CCOc1ccc(C)cc1.CC(O)CO |
| InChI | InChI=1S/C13H16O2.C3H8O2/c1-3-9-14-10-4-11-15-13-7-5-12(2)6-8-13;1-3(5)2-4/h3-8,10H,1,9,11H2,2H3;3-5H,2H2,1H3 |
| InChIKey | CNQDXWGTLYNHBF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|