C23H32O2 — CID 143183929
1-methyl-4-prop-2-enoxybenzene;(3Z,5Z)-5-propan-2-yl-2-prop-2-enoxyhepta-1,3,5-triene (PubChem CID 143183929) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-methyl-4-prop-2-enoxybenzene;(3Z,5Z)-5-propan-2-yl-2-prop-2-enoxyhepta-1,3,5-triene.
| Compound Name | 1-methyl-4-prop-2-enoxybenzene;(3Z,5Z)-5-propan-2-yl-2-prop-2-enoxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143183929 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-methyl-4-prop-2-enoxybenzene;(3Z,5Z)-5-propan-2-yl-2-prop-2-enoxyhepta-1,3,5-triene |
| SMILES | C=CCOC(=C)/C=C\C(=C/C)C(C)C.C=CCOc1ccc(C)cc1 |
| InChI | InChI=1S/C13H20O.C10H12O/c1-6-10-14-12(5)8-9-13(7-2)11(3)4;1-3-8-11-10-6-4-9(2)5-7-10/h6-9,11H,1,5,10H2,2-4H3;3-7H,1,8H2,2H3/b9-8-,13-7+; |
| InChIKey | VUGDPPNKCMZDMF-SDLQPTETSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|