C17H26O4 — CID 174744422
butane-1,4-diol;1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene (PubChem CID 174744422) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is butane-1,4-diol;1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene.
| Compound Name | butane-1,4-diol;1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene |
|---|---|
| PubChem CID | 174744422 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | butane-1,4-diol;1-methyl-4-(3-prop-2-enoxyprop-2-enoxy)benzene |
| SMILES | C=CCOC=CCOc1ccc(C)cc1.OCCCCO |
| InChI | InChI=1S/C13H16O2.C4H10O2/c1-3-9-14-10-4-11-15-13-7-5-12(2)6-8-13;5-3-1-2-4-6/h3-8,10H,1,9,11H2,2H3;5-6H,1-4H2 |
| InChIKey | RYASZVIMUXHYGD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|