C14H16O — CID 143644627
(2E,4Z)-3-(4-methylphenyl)hepta-2,4,6-trien-1-ol (PubChem CID 143644627) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (2E,4Z)-3-(4-methylphenyl)hepta-2,4,6-trien-1-ol.
| Compound Name | (2E,4Z)-3-(4-methylphenyl)hepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 143644627 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2E,4Z)-3-(4-methylphenyl)hepta-2,4,6-trien-1-ol |
| SMILES | C=C/C=C\C(=C/CO)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16O/c1-3-4-5-13(10-11-15)14-8-6-12(2)7-9-14/h3-10,15H,1,11H2,2H3/b5-4-,13-10+ |
| InChIKey | QNNPNYPRUJKZOK-GNPUEAEQSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|