C13H16O — CID 115017596
(Z)-3-cyclopropyl-3-(4-methylphenyl)prop-2-en-1-ol (PubChem CID 115017596) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-3-(4-methylphenyl)prop-2-en-1-ol.
| Compound Name | (Z)-3-cyclopropyl-3-(4-methylphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 115017596 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (Z)-3-cyclopropyl-3-(4-methylphenyl)prop-2-en-1-ol |
| SMILES | Cc1ccc(/C(=C\CO)C2CC2)cc1 |
| InChI | InChI=1S/C13H16O/c1-10-2-4-11(5-3-10)13(8-9-14)12-6-7-12/h2-5,8,12,14H,6-7,9H2,1H3/b13-8+ |
| InChIKey | NHFDYBYNFLHHDK-MDWZMJQESA-N |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |