C25H28 — CID 142975570
2-[(2E)-5-methylhexa-2,5-dien-2-yl]naphthalene;1,4-xylene (PubChem CID 142975570) has the molecular formula C25H28 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-[(2E)-5-methylhexa-2,5-dien-2-yl]naphthalene;1,4-xylene.
| Compound Name | 2-[(2E)-5-methylhexa-2,5-dien-2-yl]naphthalene;1,4-xylene |
|---|---|
| PubChem CID | 142975570 |
| Molecular Formula | C25H28 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-[(2E)-5-methylhexa-2,5-dien-2-yl]naphthalene;1,4-xylene |
| SMILES | C=C(C)C/C=C(\C)c1ccc2ccccc2c1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C17H18.C8H10/c1-13(2)8-9-14(3)16-11-10-15-6-4-5-7-17(15)12-16;1-7-3-5-8(2)6-4-7/h4-7,9-12H,1,8H2,2-3H3;3-6H,1-2H3/b14-9+; |
| InChIKey | LCCQZHQRTHCERX-KYIGKLDSSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|