C19H20O5 — CID 67581402
(2R)-2-(4-naphthalen-2-ylpent-3-enoxy)butanedioic acid (PubChem CID 67581402) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (2R)-2-(4-naphthalen-2-ylpent-3-enoxy)butanedioic acid.
| Compound Name | (2R)-2-(4-naphthalen-2-ylpent-3-enoxy)butanedioic acid |
|---|---|
| PubChem CID | 67581402 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2R)-2-(4-naphthalen-2-ylpent-3-enoxy)butanedioic acid |
| SMILES | CC(=CCCO[C@H](CC(=O)O)C(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H20O5/c1-13(5-4-10-24-17(19(22)23)12-18(20)21)15-9-8-14-6-2-3-7-16(14)11-15/h2-3,5-9,11,17H,4,10,12H2,1H3,(H,20,21)(H,22,23)/t17-/m1/s1 |
| InChIKey | KMLFQYHIYNAWBV-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|