C21H24O4 — CID 102123848
(Z,2R)-2-(naphthalene-2-carbonyloxy)dec-4-enoic acid (PubChem CID 102123848) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (Z,2R)-2-(naphthalene-2-carbonyloxy)dec-4-enoic acid.
| Compound Name | (Z,2R)-2-(naphthalene-2-carbonyloxy)dec-4-enoic acid |
|---|---|
| PubChem CID | 102123848 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (Z,2R)-2-(naphthalene-2-carbonyloxy)dec-4-enoic acid |
| SMILES | CCCCC/C=C\C[C@@H](OC(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C21H24O4/c1-2-3-4-5-6-7-12-19(20(22)23)25-21(24)18-14-13-16-10-8-9-11-17(16)15-18/h6-11,13-15,19H,2-5,12H2,1H3,(H,22,23)/b7-6-/t19-/m1/s1 |
| InChIKey | AHOFKGQMKRTXJF-LIXSYLKWSA-N |
| XLogP | 4.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|