C22H20O2 — CID 89077119
5-naphthalen-2-yl-3-phenylhex-5-enoic acid (PubChem CID 89077119) has the molecular formula C22H20O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-naphthalen-2-yl-3-phenylhex-5-enoic acid.
| Compound Name | 5-naphthalen-2-yl-3-phenylhex-5-enoic acid |
|---|---|
| PubChem CID | 89077119 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-naphthalen-2-yl-3-phenylhex-5-enoic acid |
| SMILES | C=C(CC(CC(=O)O)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H20O2/c1-16(19-12-11-18-9-5-6-10-20(18)14-19)13-21(15-22(23)24)17-7-3-2-4-8-17/h2-12,14,21H,1,13,15H2,(H,23,24) |
| InChIKey | QPULRBWIKYDEAP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |