C20H18O4S — CID 124637863
(3S)-4-naphthalen-2-ylsulfonyl-3-phenylbutanoic acid (PubChem CID 124637863) has the molecular formula C20H18O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is (3S)-4-naphthalen-2-ylsulfonyl-3-phenylbutanoic acid.
| Compound Name | (3S)-4-naphthalen-2-ylsulfonyl-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 124637863 |
| Molecular Formula | C20H18O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (3S)-4-naphthalen-2-ylsulfonyl-3-phenylbutanoic acid |
| SMILES | O=C(O)C[C@H](CS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C20H18O4S/c21-20(22)13-18(15-6-2-1-3-7-15)14-25(23,24)19-11-10-16-8-4-5-9-17(16)12-19/h1-12,18H,13-14H2,(H,21,22)/t18-/m1/s1 |
| InChIKey | CIMXLEKTIQGSME-GOSISDBHSA-N |
| XLogP | 3.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |