C14H16O4S — CID 66223688
2-(2,2-dimethoxyethylsulfonyl)naphthalene (PubChem CID 66223688) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfonyl)naphthalene.
| Compound Name | 2-(2,2-dimethoxyethylsulfonyl)naphthalene |
|---|---|
| PubChem CID | 66223688 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfonyl)naphthalene |
| SMILES | COC(CS(=O)(=O)c1ccc2ccccc2c1)OC |
| InChI | InChI=1S/C14H16O4S/c1-17-14(18-2)10-19(15,16)13-8-7-11-5-3-4-6-12(11)9-13/h3-9,14H,10H2,1-2H3 |
| InChIKey | UPENZYOTXAZQEY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|