C19H26NO2S+ — CID 7263273
1-[(2S)-1-naphthalen-2-ylsulfonylpropan-2-yl]azepan-1-ium (PubChem CID 7263273) has the molecular formula C19H26NO2S+ and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-[(2S)-1-naphthalen-2-ylsulfonylpropan-2-yl]azepan-1-ium.
| Compound Name | 1-[(2S)-1-naphthalen-2-ylsulfonylpropan-2-yl]azepan-1-ium |
|---|---|
| PubChem CID | 7263273 |
| Molecular Formula | C19H26NO2S+ |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[(2S)-1-naphthalen-2-ylsulfonylpropan-2-yl]azepan-1-ium |
| SMILES | C[C@@H](CS(=O)(=O)c1ccc2ccccc2c1)[NH+]1CCCCCC1 |
| InChI | InChI=1S/C19H25NO2S/c1-16(20-12-6-2-3-7-13-20)15-23(21,22)19-11-10-17-8-4-5-9-18(17)14-19/h4-5,8-11,14,16H,2-3,6-7,12-13,15H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | BAWJYYKAXLBQTP-INIZCTEOSA-O |
| XLogP | 2.46 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |