C24H30N3O2S+ — CID 7498083
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]naphthalene-2-sulfonamide (PubChem CID 7498083) has the molecular formula C24H30N3O2S+ and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 7498083 |
| Molecular Formula | C24H30N3O2S+ |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]naphthalene-2-sulfonamide |
| SMILES | CN(C)c1ccc([C@H](CNS(=O)(=O)c2ccc3ccccc3c2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O2S/c1-26(2)22-12-9-20(10-13-22)24(27-15-5-6-16-27)18-25-30(28,29)23-14-11-19-7-3-4-8-21(19)17-23/h3-4,7-14,17,24-25H,5-6,15-16,18H2,1-2H3/p+1/t24-/m0/s1 |
| InChIKey | QAIZGTKZYJWONI-DEOSSOPVSA-O |
| XLogP | 2.60 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|