C22H32N3O3S+ — CID 7498027
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 7498027) has the molecular formula C22H32N3O3S+ and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 7498027 |
| Molecular Formula | C22H32N3O3S+ |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NC[C@H](c1ccc(N(C)C)cc1)[NH+]1CCCC1 |
| InChI | InChI=1S/C22H31N3O3S/c1-17-7-12-21(28-4)22(15-17)29(26,27)23-16-20(25-13-5-6-14-25)18-8-10-19(11-9-18)24(2)3/h7-12,15,20,23H,5-6,13-14,16H2,1-4H3/p+1/t20-/m1/s1 |
| InChIKey | RUJBSJSWBYABMS-HXUWFJFHSA-O |
| XLogP | 1.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|