C23H32N2O2S — CID 2211387
1-[(2S)-3-naphthalen-2-ylsulfonyl-2-piperidin-1-ylpropyl]piperidine (PubChem CID 2211387) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-[(2S)-3-naphthalen-2-ylsulfonyl-2-piperidin-1-ylpropyl]piperidine.
| Compound Name | 1-[(2S)-3-naphthalen-2-ylsulfonyl-2-piperidin-1-ylpropyl]piperidine |
|---|---|
| PubChem CID | 2211387 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-[(2S)-3-naphthalen-2-ylsulfonyl-2-piperidin-1-ylpropyl]piperidine |
| SMILES | O=S(=O)(C[C@H](CN1CCCCC1)N1CCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H32N2O2S/c26-28(27,23-12-11-20-9-3-4-10-21(20)17-23)19-22(25-15-7-2-8-16-25)18-24-13-5-1-6-14-24/h3-4,9-12,17,22H,1-2,5-8,13-16,18-19H2/t22-/m0/s1 |
| InChIKey | GJUQNXFCNZTWKL-QFIPXVFZSA-N |
| XLogP | 3.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |