C23H26N2O2S — CID 26542141
N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]naphthalene-2-sulfonamide (PubChem CID 26542141) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 26542141 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1CN1CCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H26N2O2S/c26-28(27,23-13-12-19-8-2-3-9-20(19)16-23)24-17-21-10-4-5-11-22(21)18-25-14-6-1-7-15-25/h2-5,8-13,16,24H,1,6-7,14-15,17-18H2 |
| InChIKey | TVRJPGKIRWSMQG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |