C20H23N3O2S — CID 26542199
3-cyano-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 26542199) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-cyano-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26542199 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-cyano-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)NCc2ccccc2CN2CCCCC2)c1 |
| InChI | InChI=1S/C20H23N3O2S/c21-14-17-7-6-10-20(13-17)26(24,25)22-15-18-8-2-3-9-19(18)16-23-11-4-1-5-12-23/h2-3,6-10,13,22H,1,4-5,11-12,15-16H2 |
| InChIKey | MGUAWCMUPQKORJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |