C15H18O3S — CID 69383125
(3S)-3-methyl-4-naphthalen-2-ylsulfonylbutan-1-ol (PubChem CID 69383125) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is (3S)-3-methyl-4-naphthalen-2-ylsulfonylbutan-1-ol.
| Compound Name | (3S)-3-methyl-4-naphthalen-2-ylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 69383125 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (3S)-3-methyl-4-naphthalen-2-ylsulfonylbutan-1-ol |
| SMILES | C[C@@H](CCO)CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H18O3S/c1-12(8-9-16)11-19(17,18)15-7-6-13-4-2-3-5-14(13)10-15/h2-7,10,12,16H,8-9,11H2,1H3/t12-/m0/s1 |
| InChIKey | OHMFVYAQDXCDNI-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |