About 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene
2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene (PubChem CID 65017357) has the molecular formula C17H21BrO2S
and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene.
Molecular Properties
| Compound Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene |
| PubChem CID | 65017357 |
| Molecular Formula | C17H21BrO2S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene |
| SMILES | CC(C)(C)C(CBr)CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H21BrO2S/c1-17(2,3)15(11-18)12-21(19,20)16-9-8-13-6-4-5-7-14(13)10-16/h4-10,15H,11-12H2,1-3H3 |
| InChIKey | UKVHDHNYJOXHAF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene?
The IUPAC name of 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene (CID 65017357) is 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene.
What is the SMILES notation for 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene?
The canonical SMILES for 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene is CC(C)(C)C(CBr)CS(=O)(=O)c1ccc2ccccc2c1.
What is the InChIKey of 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene?
The InChIKey is UKVHDHNYJOXHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrO2S/c1-17(2,3)15(11-18)12-21(19,20)16-9-8-13-6-4-5-7-14(13)10-16/h4-10,15H,11-12H2,1-3H3.
What are the key properties of 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene?
2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene has a molecular weight of 369.32 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonylnaphthalene is sourced from PubChem (CID 65017357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).